C29H32N4O4S — CID 158802073
7-methoxy-1-[3-[[8-(morpholine-4-carbonyl)thieno[2,3-h]quinazolin-2-yl]amino]phenyl]heptan-2-one (PubChem CID 158802073) has the molecular formula C29H32N4O4S and a molecular weight of 532.67 g/mol. Its IUPAC name is 7-methoxy-1-[3-[[8-(morpholine-4-carbonyl)thieno[2,3-h]quinazolin-2-yl]amino]phenyl]heptan-2-one.
| Compound Name | 7-methoxy-1-[3-[[8-(morpholine-4-carbonyl)thieno[2,3-h]quinazolin-2-yl]amino]phenyl]heptan-2-one |
|---|---|
| PubChem CID | 158802073 |
| Molecular Formula | C29H32N4O4S |
| Molecular Weight | 532.67 g/mol |
| Exact Mass | 532.21 |
| IUPAC Name | 7-methoxy-1-[3-[[8-(morpholine-4-carbonyl)thieno[2,3-h]quinazolin-2-yl]amino]phenyl]heptan-2-one |
| SMILES | COCCCCCC(=O)Cc1cccc(Nc2ncc3ccc4sc(C(=O)N5CCOCC5)cc4c3n2)c1 |
| InChI | InChI=1S/C29H32N4O4S/c1-36-13-4-2-3-8-23(34)17-20-6-5-7-22(16-20)31-29-30-19-21-9-10-25-24(27(21)32-29)18-26(38-25)28(35)33-11-14-37-15-12-33/h5-7,9-10,16,18-19H,2-4,8,11-15,17H2,1H3,(H,30,31,32) |
| InChIKey | ITPMZLQYLSUJAX-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 93.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.67 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|