C26H22N6OS — CID 59262756
piperazin-1-yl-[2-(3-pyridin-3-ylanilino)thieno[2,3-h]quinazolin-8-yl]methanone (PubChem CID 59262756) has the molecular formula C26H22N6OS and a molecular weight of 466.57 g/mol. Its IUPAC name is piperazin-1-yl-[2-(3-pyridin-3-ylanilino)thieno[2,3-h]quinazolin-8-yl]methanone.
| Compound Name | piperazin-1-yl-[2-(3-pyridin-3-ylanilino)thieno[2,3-h]quinazolin-8-yl]methanone |
|---|---|
| PubChem CID | 59262756 |
| Molecular Formula | C26H22N6OS |
| Molecular Weight | 466.57 g/mol |
| Exact Mass | 466.16 |
| IUPAC Name | piperazin-1-yl-[2-(3-pyridin-3-ylanilino)thieno[2,3-h]quinazolin-8-yl]methanone |
| SMILES | O=C(c1cc2c(ccc3cnc(Nc4cccc(-c5cccnc5)c4)nc32)s1)N1CCNCC1 |
| InChI | InChI=1S/C26H22N6OS/c33-25(32-11-9-27-10-12-32)23-14-21-22(34-23)7-6-19-16-29-26(31-24(19)21)30-20-5-1-3-17(13-20)18-4-2-8-28-15-18/h1-8,13-16,27H,9-12H2,(H,29,30,31) |
| InChIKey | CWQNUMXMJXKVJK-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 83.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.57 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |