C13H16N4OS2 — CID 173484241
[5-(aminomethylidene)-4-imino-7H-thieno[2,3-c]thiopyran-2-yl]-piperazin-1-ylmethanone (PubChem CID 173484241) has the molecular formula C13H16N4OS2 and a molecular weight of 308.43 g/mol. Its IUPAC name is [5-(aminomethylidene)-4-imino-7H-thieno[2,3-c]thiopyran-2-yl]-piperazin-1-ylmethanone.
| Compound Name | [5-(aminomethylidene)-4-imino-7H-thieno[2,3-c]thiopyran-2-yl]-piperazin-1-ylmethanone |
|---|---|
| PubChem CID | 173484241 |
| Molecular Formula | C13H16N4OS2 |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | [5-(aminomethylidene)-4-imino-7H-thieno[2,3-c]thiopyran-2-yl]-piperazin-1-ylmethanone |
| SMILES | [H]/N=C1\C(=CN)SCc2sc(C(=O)N3CCNCC3)cc21 |
| InChI | InChI=1S/C13H16N4OS2/c14-6-10-12(15)8-5-9(20-11(8)7-19-10)13(18)17-3-1-16-2-4-17/h5-6,15-16H,1-4,7,14H2/b10-6?,15-12- |
| InChIKey | MRAMIJVBPPYOIL-IINSIKRPSA-N |
| XLogP | 1.21 |
| TPSA | 82.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|