C22H18N4OS — CID 89125799
3-[2-(3-aminoanilino)-5,6-dihydrothieno[2,3-h]quinazolin-8-yl]phenol (PubChem CID 89125799) has the molecular formula C22H18N4OS and a molecular weight of 386.48 g/mol. Its IUPAC name is 3-[2-(3-aminoanilino)-5,6-dihydrothieno[2,3-h]quinazolin-8-yl]phenol.
| Compound Name | 3-[2-(3-aminoanilino)-5,6-dihydrothieno[2,3-h]quinazolin-8-yl]phenol |
|---|---|
| PubChem CID | 89125799 |
| Molecular Formula | C22H18N4OS |
| Molecular Weight | 386.48 g/mol |
| Exact Mass | 386.12 |
| IUPAC Name | 3-[2-(3-aminoanilino)-5,6-dihydrothieno[2,3-h]quinazolin-8-yl]phenol |
| SMILES | Nc1cccc(Nc2ncc3c(n2)-c2cc(-c4cccc(O)c4)sc2CC3)c1 |
| InChI | InChI=1S/C22H18N4OS/c23-15-4-2-5-16(10-15)25-22-24-12-14-7-8-19-18(21(14)26-22)11-20(28-19)13-3-1-6-17(27)9-13/h1-6,9-12,27H,7-8,23H2,(H,24,25,26) |
| InChIKey | VWIFJEXKZFZTAD-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 84.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.48 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|