C22H16N3O3S2- — CID 70947057
4-[[8-(3-hydroxyphenyl)-5,6-dihydrothieno[2,3-h]quinazolin-2-yl]amino]benzenesulfinate (PubChem CID 70947057) has the molecular formula C22H16N3O3S2- and a molecular weight of 434.52 g/mol. Its IUPAC name is 4-[[8-(3-hydroxyphenyl)-5,6-dihydrothieno[2,3-h]quinazolin-2-yl]amino]benzenesulfinate.
| Compound Name | 4-[[8-(3-hydroxyphenyl)-5,6-dihydrothieno[2,3-h]quinazolin-2-yl]amino]benzenesulfinate |
|---|---|
| PubChem CID | 70947057 |
| Molecular Formula | C22H16N3O3S2- |
| Molecular Weight | 434.52 g/mol |
| Exact Mass | 434.06 |
| IUPAC Name | 4-[[8-(3-hydroxyphenyl)-5,6-dihydrothieno[2,3-h]quinazolin-2-yl]amino]benzenesulfinate |
| SMILES | O=S([O-])c1ccc(Nc2ncc3c(n2)-c2cc(-c4cccc(O)c4)sc2CC3)cc1 |
| InChI | InChI=1S/C22H17N3O3S2/c26-16-3-1-2-13(10-16)20-11-18-19(29-20)9-4-14-12-23-22(25-21(14)18)24-15-5-7-17(8-6-15)30(27)28/h1-3,5-8,10-12,26H,4,9H2,(H,27,28)(H,23,24,25)/p-1 |
| InChIKey | UJGMQHGGMZYLLY-UHFFFAOYSA-M |
| XLogP | 4.66 |
| TPSA | 98.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.52 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|