C18H20N4S — CID 163480567
N-(3,5-dimethylphenyl)-2-methyl-2,3,4,5-tetrahydro-[1,3]thiazolo[4,5-h]quinazolin-8-amine (PubChem CID 163480567) has the molecular formula C18H20N4S and a molecular weight of 324.45 g/mol. Its IUPAC name is N-(3,5-dimethylphenyl)-2-methyl-2,3,4,5-tetrahydro-[1,3]thiazolo[4,5-h]quinazolin-8-amine.
| Compound Name | N-(3,5-dimethylphenyl)-2-methyl-2,3,4,5-tetrahydro-[1,3]thiazolo[4,5-h]quinazolin-8-amine |
|---|---|
| PubChem CID | 163480567 |
| Molecular Formula | C18H20N4S |
| Molecular Weight | 324.45 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | N-(3,5-dimethylphenyl)-2-methyl-2,3,4,5-tetrahydro-[1,3]thiazolo[4,5-h]quinazolin-8-amine |
| SMILES | Cc1cc(C)cc(Nc2ncc3c(n2)C2=C(CC3)NC(C)S2)c1 |
| InChI | InChI=1S/C18H20N4S/c1-10-6-11(2)8-14(7-10)21-18-19-9-13-4-5-15-17(16(13)22-18)23-12(3)20-15/h6-9,12,20H,4-5H2,1-3H3,(H,19,21,22) |
| InChIKey | CEDWFGJGOCAUPW-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.45 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |