C19H17N5O2 — CID 143039309
4-amino-2-(2,5-dihydroxyphenyl)-6-[3-(methylaminomethyl)phenyl]pyrimidine-5-carbonitrile (PubChem CID 143039309) has the molecular formula C19H17N5O2 and a molecular weight of 347.38 g/mol. Its IUPAC name is 4-amino-2-(2,5-dihydroxyphenyl)-6-[3-(methylaminomethyl)phenyl]pyrimidine-5-carbonitrile.
| Compound Name | 4-amino-2-(2,5-dihydroxyphenyl)-6-[3-(methylaminomethyl)phenyl]pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 143039309 |
| Molecular Formula | C19H17N5O2 |
| Molecular Weight | 347.38 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | 4-amino-2-(2,5-dihydroxyphenyl)-6-[3-(methylaminomethyl)phenyl]pyrimidine-5-carbonitrile |
| SMILES | CNCc1cccc(-c2nc(-c3cc(O)ccc3O)nc(N)c2C#N)c1 |
| InChI | InChI=1S/C19H17N5O2/c1-22-10-11-3-2-4-12(7-11)17-15(9-20)18(21)24-19(23-17)14-8-13(25)5-6-16(14)26/h2-8,22,25-26H,10H2,1H3,(H2,21,23,24) |
| InChIKey | RQBOKRHLTVLVDU-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 128.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.38 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|