C15H21N3O4 — CID 143039987
N-hydroxy-4-[[3-hydroxypropyl(prop-1-en-2-ylcarbamoyl)amino]methyl]benzamide (PubChem CID 143039987) has the molecular formula C15H21N3O4 and a molecular weight of 307.35 g/mol. Its IUPAC name is N-hydroxy-4-[[3-hydroxypropyl(prop-1-en-2-ylcarbamoyl)amino]methyl]benzamide.
| Compound Name | N-hydroxy-4-[[3-hydroxypropyl(prop-1-en-2-ylcarbamoyl)amino]methyl]benzamide |
|---|---|
| PubChem CID | 143039987 |
| Molecular Formula | C15H21N3O4 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.15 |
| IUPAC Name | N-hydroxy-4-[[3-hydroxypropyl(prop-1-en-2-ylcarbamoyl)amino]methyl]benzamide |
| SMILES | C=C(C)NC(=O)N(CCCO)Cc1ccc(C(=O)NO)cc1 |
| InChI | InChI=1S/C15H21N3O4/c1-11(2)16-15(21)18(8-3-9-19)10-12-4-6-13(7-5-12)14(20)17-22/h4-7,19,22H,1,3,8-10H2,2H3,(H,16,21)(H,17,20) |
| InChIKey | QGVWXHQHCAULQD-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|