C19H22N2O7 — CID 87545769
[4-(hydroxycarbamoyl)phenyl]methyl-[(3,4,5-trimethoxyphenyl)methyl]carbamic acid (PubChem CID 87545769) has the molecular formula C19H22N2O7 and a molecular weight of 390.39 g/mol. Its IUPAC name is [4-(hydroxycarbamoyl)phenyl]methyl-[(3,4,5-trimethoxyphenyl)methyl]carbamic acid.
| Compound Name | [4-(hydroxycarbamoyl)phenyl]methyl-[(3,4,5-trimethoxyphenyl)methyl]carbamic acid |
|---|---|
| PubChem CID | 87545769 |
| Molecular Formula | C19H22N2O7 |
| Molecular Weight | 390.39 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | [4-(hydroxycarbamoyl)phenyl]methyl-[(3,4,5-trimethoxyphenyl)methyl]carbamic acid |
| SMILES | COc1cc(CN(Cc2ccc(C(=O)NO)cc2)C(=O)O)cc(OC)c1OC |
| InChI | InChI=1S/C19H22N2O7/c1-26-15-8-13(9-16(27-2)17(15)28-3)11-21(19(23)24)10-12-4-6-14(7-5-12)18(22)20-25/h4-9,25H,10-11H2,1-3H3,(H,20,22)(H,23,24) |
| InChIKey | WIMSCKVEBIFLFG-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 117.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.39 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|