C24H34N2O8 — CID 138592054
4-[bis[(3,4,5-trimethoxyphenyl)methyl]amino]-N-hydroxybutanamide (PubChem CID 138592054) has the molecular formula C24H34N2O8 and a molecular weight of 478.54 g/mol. Its IUPAC name is 4-[bis[(3,4,5-trimethoxyphenyl)methyl]amino]-N-hydroxybutanamide.
| Compound Name | 4-[bis[(3,4,5-trimethoxyphenyl)methyl]amino]-N-hydroxybutanamide |
|---|---|
| PubChem CID | 138592054 |
| Molecular Formula | C24H34N2O8 |
| Molecular Weight | 478.54 g/mol |
| Exact Mass | 478.23 |
| IUPAC Name | 4-[bis[(3,4,5-trimethoxyphenyl)methyl]amino]-N-hydroxybutanamide |
| SMILES | COc1cc(CN(CCCC(=O)NO)Cc2cc(OC)c(OC)c(OC)c2)cc(OC)c1OC |
| InChI | InChI=1S/C24H34N2O8/c1-29-18-10-16(11-19(30-2)23(18)33-5)14-26(9-7-8-22(27)25-28)15-17-12-20(31-3)24(34-6)21(13-17)32-4/h10-13,28H,7-9,14-15H2,1-6H3,(H,25,27) |
| InChIKey | MVVNSIVPXVWZNC-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 107.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.54 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|