C27H43F3N2O — CID 143040842
N-benzyl-N-[(1E,3E)-2,3-dimethylpenta-1,3-dienyl]-1,2,3,6-tetrahydropyridin-4-amine;ethane;3-(trifluoromethoxy)prop-1-ene (PubChem CID 143040842) has the molecular formula C27H43F3N2O and a molecular weight of 468.65 g/mol. Its IUPAC name is N-benzyl-N-[(1E,3E)-2,3-dimethylpenta-1,3-dienyl]-1,2,3,6-tetrahydropyridin-4-amine;ethane;3-(trifluoromethoxy)prop-1-ene.
| Compound Name | N-benzyl-N-[(1E,3E)-2,3-dimethylpenta-1,3-dienyl]-1,2,3,6-tetrahydropyridin-4-amine;ethane;3-(trifluoromethoxy)prop-1-ene |
|---|---|
| PubChem CID | 143040842 |
| Molecular Formula | C27H43F3N2O |
| Molecular Weight | 468.65 g/mol |
| Exact Mass | 468.33 |
| IUPAC Name | N-benzyl-N-[(1E,3E)-2,3-dimethylpenta-1,3-dienyl]-1,2,3,6-tetrahydropyridin-4-amine;ethane;3-(trifluoromethoxy)prop-1-ene |
| SMILES | C/C=C(C)/C(C)=C/N(Cc1ccccc1)C1=CCNCC1.C=CCOC(F)(F)F.CC.CC |
| InChI | InChI=1S/C19H26N2.C4H5F3O.2C2H6/c1-4-16(2)17(3)14-21(19-10-12-20-13-11-19)15-18-8-6-5-7-9-18;1-2-3-8-4(5,6)7;2*1-2/h4-10,14,20H,11-13,15H2,1-3H3;2H,1,3H2;2*1-2H3/b16-4+,17-14+;;; |
| InChIKey | FYBBDLPMWUNFRP-RIHYMPQYSA-N |
| XLogP | 8.00 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.65 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|