C22H32N2O — CID 143040891
N-benzyl-N-[(1E,3E)-3-methylpenta-1,3-dienyl]-1,2,3,6-tetrahydropyridin-4-amine;3-methoxyprop-1-ene (PubChem CID 143040891) has the molecular formula C22H32N2O and a molecular weight of 340.51 g/mol. Its IUPAC name is N-benzyl-N-[(1E,3E)-3-methylpenta-1,3-dienyl]-1,2,3,6-tetrahydropyridin-4-amine;3-methoxyprop-1-ene.
| Compound Name | N-benzyl-N-[(1E,3E)-3-methylpenta-1,3-dienyl]-1,2,3,6-tetrahydropyridin-4-amine;3-methoxyprop-1-ene |
|---|---|
| PubChem CID | 143040891 |
| Molecular Formula | C22H32N2O |
| Molecular Weight | 340.51 g/mol |
| Exact Mass | 340.25 |
| IUPAC Name | N-benzyl-N-[(1E,3E)-3-methylpenta-1,3-dienyl]-1,2,3,6-tetrahydropyridin-4-amine;3-methoxyprop-1-ene |
| SMILES | C/C=C(C)/C=C/N(Cc1ccccc1)C1=CCNCC1.C=CCOC |
| InChI | InChI=1S/C18H24N2.C4H8O/c1-3-16(2)11-14-20(18-9-12-19-13-10-18)15-17-7-5-4-6-8-17;1-3-4-5-2/h3-9,11,14,19H,10,12-13,15H2,1-2H3;3H,1,4H2,2H3/b14-11+,16-3+; |
| InChIKey | JFNALGFNSPYSOF-PHJSOODXSA-N |
| XLogP | 4.66 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.51 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|