C20H28N2 — CID 143040837
N-benzyl-N-[(1E,3E)-2,3-dimethylpenta-1,3-dienyl]-5-methyl-1,2,3,6-tetrahydropyridin-4-amine (PubChem CID 143040837) has the molecular formula C20H28N2 and a molecular weight of 296.46 g/mol. Its IUPAC name is N-benzyl-N-[(1E,3E)-2,3-dimethylpenta-1,3-dienyl]-5-methyl-1,2,3,6-tetrahydropyridin-4-amine.
| Compound Name | N-benzyl-N-[(1E,3E)-2,3-dimethylpenta-1,3-dienyl]-5-methyl-1,2,3,6-tetrahydropyridin-4-amine |
|---|---|
| PubChem CID | 143040837 |
| Molecular Formula | C20H28N2 |
| Molecular Weight | 296.46 g/mol |
| Exact Mass | 296.23 |
| IUPAC Name | N-benzyl-N-[(1E,3E)-2,3-dimethylpenta-1,3-dienyl]-5-methyl-1,2,3,6-tetrahydropyridin-4-amine |
| SMILES | C/C=C(C)/C(C)=C/N(Cc1ccccc1)C1=C(C)CNCC1 |
| InChI | InChI=1S/C20H28N2/c1-5-16(2)18(4)14-22(15-19-9-7-6-8-10-19)20-11-12-21-13-17(20)3/h5-10,14,21H,11-13,15H2,1-4H3/b16-5+,18-14+ |
| InChIKey | NDVQNAHWHFYHQL-XOQLVIOASA-N |
| XLogP | 4.63 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.46 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|