About 3-methyl-1-benzothiophene;4-methylchromen-2-one;quinoxaline
3-methyl-1-benzothiophene;4-methylchromen-2-one;quinoxaline (PubChem CID 143043140) has the molecular formula C27H22N2O2S
and a molecular weight of 438.55 g/mol. Its IUPAC name is 3-methyl-1-benzothiophene;4-methylchromen-2-one;quinoxaline.
Molecular Properties
| Compound Name | 3-methyl-1-benzothiophene;4-methylchromen-2-one;quinoxaline |
| PubChem CID | 143043140 |
| Molecular Formula | C27H22N2O2S |
| Molecular Weight | 438.55 g/mol |
| Exact Mass | 438.14 |
| IUPAC Name | 3-methyl-1-benzothiophene;4-methylchromen-2-one;quinoxaline |
| SMILES | Cc1cc(=O)oc2ccccc12.Cc1csc2ccccc12.c1ccc2nccnc2c1 |
| InChI | InChI=1S/C10H8O2.C9H8S.C8H6N2/c1-7-6-10(11)12-9-5-3-2-4-8(7)9;1-7-6-10-9-5-3-2-4-8(7)9;1-2-4-8-7(3-1)9-5-6-10-8/h2-6H,1H3;2-6H,1H3;1-6H |
| InChIKey | FTOYNOZPPADSLP-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 55.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 438.55 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 3-methyl-1-benzothiophene;4-methylchromen-2-one;quinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-1-benzothiophene;4-methylchromen-2-one;quinoxaline?
The IUPAC name of 3-methyl-1-benzothiophene;4-methylchromen-2-one;quinoxaline (CID 143043140) is 3-methyl-1-benzothiophene;4-methylchromen-2-one;quinoxaline.
What is the SMILES notation for 3-methyl-1-benzothiophene;4-methylchromen-2-one;quinoxaline?
The canonical SMILES for 3-methyl-1-benzothiophene;4-methylchromen-2-one;quinoxaline is Cc1cc(=O)oc2ccccc12.Cc1csc2ccccc12.c1ccc2nccnc2c1.
What is the InChIKey of 3-methyl-1-benzothiophene;4-methylchromen-2-one;quinoxaline?
The InChIKey is FTOYNOZPPADSLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8O2.C9H8S.C8H6N2/c1-7-6-10(11)12-9-5-3-2-4-8(7)9;1-7-6-10-9-5-3-2-4-8(7)9;1-2-4-8-7(3-1)9-5-6-10-8/h2-6H,1H3;2-6H,1H3;1-6H.
What are the key properties of 3-methyl-1-benzothiophene;4-methylchromen-2-one;quinoxaline?
3-methyl-1-benzothiophene;4-methylchromen-2-one;quinoxaline has a molecular weight of 438.55 g/mol, XLogP of 6.94, 0 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-1-benzothiophene;4-methylchromen-2-one;quinoxaline is sourced from PubChem (CID 143043140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).