C19H20N2O3S — CID 143043721
(2Z,4E)-N-[(2,4-dimethoxyphenyl)methyl]-5-pyridin-2-yl-2-sulfanylpenta-2,4-dienamide (PubChem CID 143043721) has the molecular formula C19H20N2O3S and a molecular weight of 356.45 g/mol. Its IUPAC name is (2Z,4E)-N-[(2,4-dimethoxyphenyl)methyl]-5-pyridin-2-yl-2-sulfanylpenta-2,4-dienamide.
| Compound Name | (2Z,4E)-N-[(2,4-dimethoxyphenyl)methyl]-5-pyridin-2-yl-2-sulfanylpenta-2,4-dienamide |
|---|---|
| PubChem CID | 143043721 |
| Molecular Formula | C19H20N2O3S |
| Molecular Weight | 356.45 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | (2Z,4E)-N-[(2,4-dimethoxyphenyl)methyl]-5-pyridin-2-yl-2-sulfanylpenta-2,4-dienamide |
| SMILES | COc1ccc(CNC(=O)/C(S)=C/C=C/c2ccccn2)c(OC)c1 |
| InChI | InChI=1S/C19H20N2O3S/c1-23-16-10-9-14(17(12-16)24-2)13-21-19(22)18(25)8-5-7-15-6-3-4-11-20-15/h3-12,25H,13H2,1-2H3,(H,21,22)/b7-5+,18-8- |
| InChIKey | YXAKRBFWYCATMM-FJJFEQPVSA-N |
| XLogP | 3.24 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.45 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|