C20H28N2O2 — CID 143044166
3-(2-aminoethyl)-N-[2-(3,4-dimethoxyphenyl)ethyl]-4-ethylaniline (PubChem CID 143044166) has the molecular formula C20H28N2O2 and a molecular weight of 328.46 g/mol. Its IUPAC name is 3-(2-aminoethyl)-N-[2-(3,4-dimethoxyphenyl)ethyl]-4-ethylaniline.
| Compound Name | 3-(2-aminoethyl)-N-[2-(3,4-dimethoxyphenyl)ethyl]-4-ethylaniline |
|---|---|
| PubChem CID | 143044166 |
| Molecular Formula | C20H28N2O2 |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.22 |
| IUPAC Name | 3-(2-aminoethyl)-N-[2-(3,4-dimethoxyphenyl)ethyl]-4-ethylaniline |
| SMILES | CCc1ccc(NCCc2ccc(OC)c(OC)c2)cc1CCN |
| InChI | InChI=1S/C20H28N2O2/c1-4-16-6-7-18(14-17(16)9-11-21)22-12-10-15-5-8-19(23-2)20(13-15)24-3/h5-8,13-14,22H,4,9-12,21H2,1-3H3 |
| InChIKey | XHKJLHFJRBYMQE-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |