C30H33N5O6S — CID 143044553
(5E)-5-[1-[3-[2-[4-butanimidoyl-2-(3,4-dimethoxyphenyl)-5-(methylamino)-6-oxopyrimidin-1-yl]ethoxy]phenyl]ethylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 143044553) has the molecular formula C30H33N5O6S and a molecular weight of 591.69 g/mol. Its IUPAC name is (5E)-5-[1-[3-[2-[4-butanimidoyl-2-(3,4-dimethoxyphenyl)-5-(methylamino)-6-oxopyrimidin-1-yl]ethoxy]phenyl]ethylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[1-[3-[2-[4-butanimidoyl-2-(3,4-dimethoxyphenyl)-5-(methylamino)-6-oxopyrimidin-1-yl]ethoxy]phenyl]ethylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 143044553 |
| Molecular Formula | C30H33N5O6S |
| Molecular Weight | 591.69 g/mol |
| Exact Mass | 591.22 |
| IUPAC Name | (5E)-5-[1-[3-[2-[4-butanimidoyl-2-(3,4-dimethoxyphenyl)-5-(methylamino)-6-oxopyrimidin-1-yl]ethoxy]phenyl]ethylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | [H]/N=C(\CCC)c1nc(-c2ccc(OC)c(OC)c2)n(CCOc2cccc(/C(C)=C3/SC(=O)NC3=O)c2)c(=O)c1NC |
| InChI | InChI=1S/C30H33N5O6S/c1-6-8-21(31)24-25(32-3)29(37)35(27(33-24)19-11-12-22(39-4)23(16-19)40-5)13-14-41-20-10-7-9-18(15-20)17(2)26-28(36)34-30(38)42-26/h7,9-12,15-16,31-32H,6,8,13-14H2,1-5H3,(H,34,36,38)/b26-17+,31-21+ |
| InChIKey | OKRBJYUVQOFBCL-PBCHQVSGSA-N |
| XLogP | 4.93 |
| TPSA | 144.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.69 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|