C22H24NO4P — CID 143045664
9,13-dimethyl-7,18,20-trioxa-13-aza-9-phosphahexacyclo[12.11.0.02,11.05,10.015,23.017,21]pentacosa-2(11),3,5(10),15,17(21),22-hexaen-25-ol (PubChem CID 143045664) has the molecular formula C22H24NO4P and a molecular weight of 397.41 g/mol. Its IUPAC name is 9,13-dimethyl-7,18,20-trioxa-13-aza-9-phosphahexacyclo[12.11.0.02,11.05,10.015,23.017,21]pentacosa-2(11),3,5(10),15,17(21),22-hexaen-25-ol.
| Compound Name | 9,13-dimethyl-7,18,20-trioxa-13-aza-9-phosphahexacyclo[12.11.0.02,11.05,10.015,23.017,21]pentacosa-2(11),3,5(10),15,17(21),22-hexaen-25-ol |
|---|---|
| PubChem CID | 143045664 |
| Molecular Formula | C22H24NO4P |
| Molecular Weight | 397.41 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | 9,13-dimethyl-7,18,20-trioxa-13-aza-9-phosphahexacyclo[12.11.0.02,11.05,10.015,23.017,21]pentacosa-2(11),3,5(10),15,17(21),22-hexaen-25-ol |
| SMILES | CN1Cc2c(ccc3c2P(C)COC3)C2C(O)Cc3cc4c(cc3C21)OCO4 |
| InChI | InChI=1S/C22H24NO4P/c1-23-8-16-14(4-3-12-9-25-11-28(2)22(12)16)20-17(24)5-13-6-18-19(27-10-26-18)7-15(13)21(20)23/h3-4,6-7,17,20-21,24H,5,8-11H2,1-2H3 |
| InChIKey | ASNIJLFQWQUJSV-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.41 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|