C19H17NO5 — CID 101148425
(1R,12R)-23-methyl-5,7,16,18-tetraoxa-23-azahexacyclo[10.10.1.02,10.04,8.013,21.015,19]tricosa-2,4(8),9,13,15(19),20-hexaen-1-ol (PubChem CID 101148425) has the molecular formula C19H17NO5 and a molecular weight of 339.35 g/mol. Its IUPAC name is (1R,12R)-23-methyl-5,7,16,18-tetraoxa-23-azahexacyclo[10.10.1.02,10.04,8.013,21.015,19]tricosa-2,4(8),9,13,15(19),20-hexaen-1-ol.
| Compound Name | (1R,12R)-23-methyl-5,7,16,18-tetraoxa-23-azahexacyclo[10.10.1.02,10.04,8.013,21.015,19]tricosa-2,4(8),9,13,15(19),20-hexaen-1-ol |
|---|---|
| PubChem CID | 101148425 |
| Molecular Formula | C19H17NO5 |
| Molecular Weight | 339.35 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | (1R,12R)-23-methyl-5,7,16,18-tetraoxa-23-azahexacyclo[10.10.1.02,10.04,8.013,21.015,19]tricosa-2,4(8),9,13,15(19),20-hexaen-1-ol |
| SMILES | CN1[C@@H]2Cc3cc4c(cc3[C@]1(O)Cc1cc3c(cc12)OCO3)OCO4 |
| InChI | InChI=1S/C19H17NO5/c1-20-14-2-10-3-15-18(25-9-22-15)6-13(10)19(20,21)7-11-4-16-17(5-12(11)14)24-8-23-16/h3-6,14,21H,2,7-9H2,1H3/t14-,19-/m1/s1 |
| InChIKey | ONEUXHSNVSOILA-AUUYWEPGSA-N |
| XLogP | 2.07 |
| TPSA | 60.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.35 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |