C20H19NO6 — CID 162989599
24-methyl-5,7,18,20-tetraoxa-24-azahexacyclo[11.11.0.02,10.04,8.014,22.017,21]tetracosa-2,4(8),9,14(22),15,17(21)-hexaene-12,15-diol (PubChem CID 162989599) has the molecular formula C20H19NO6 and a molecular weight of 369.37 g/mol. Its IUPAC name is 24-methyl-5,7,18,20-tetraoxa-24-azahexacyclo[11.11.0.02,10.04,8.014,22.017,21]tetracosa-2,4(8),9,14(22),15,17(21)-hexaene-12,15-diol.
| Compound Name | 24-methyl-5,7,18,20-tetraoxa-24-azahexacyclo[11.11.0.02,10.04,8.014,22.017,21]tetracosa-2,4(8),9,14(22),15,17(21)-hexaene-12,15-diol |
|---|---|
| PubChem CID | 162989599 |
| Molecular Formula | C20H19NO6 |
| Molecular Weight | 369.37 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | 24-methyl-5,7,18,20-tetraoxa-24-azahexacyclo[11.11.0.02,10.04,8.014,22.017,21]tetracosa-2,4(8),9,14(22),15,17(21)-hexaene-12,15-diol |
| SMILES | CN1Cc2c3c(cc(O)c2C2C(O)Cc4cc5c(cc4C21)OCO5)OCO3 |
| InChI | InChI=1S/C20H19NO6/c1-21-6-11-17(13(23)5-16-20(11)27-8-26-16)18-12(22)2-9-3-14-15(25-7-24-14)4-10(9)19(18)21/h3-5,12,18-19,22-23H,2,6-8H2,1H3 |
| InChIKey | RWDWPBLTGUWECU-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 80.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.37 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |