C19H35N3O2 — CID 143046244
N-[2-[4-[(3Z)-5-(2-methoxyethoxy)hexa-1,3,5-trien-2-yl]piperazin-1-yl]ethyl]-N-methylpropan-1-amine (PubChem CID 143046244) has the molecular formula C19H35N3O2 and a molecular weight of 337.51 g/mol. Its IUPAC name is N-[2-[4-[(3Z)-5-(2-methoxyethoxy)hexa-1,3,5-trien-2-yl]piperazin-1-yl]ethyl]-N-methylpropan-1-amine.
| Compound Name | N-[2-[4-[(3Z)-5-(2-methoxyethoxy)hexa-1,3,5-trien-2-yl]piperazin-1-yl]ethyl]-N-methylpropan-1-amine |
|---|---|
| PubChem CID | 143046244 |
| Molecular Formula | C19H35N3O2 |
| Molecular Weight | 337.51 g/mol |
| Exact Mass | 337.27 |
| IUPAC Name | N-[2-[4-[(3Z)-5-(2-methoxyethoxy)hexa-1,3,5-trien-2-yl]piperazin-1-yl]ethyl]-N-methylpropan-1-amine |
| SMILES | C=C(/C=C\C(=C)N1CCN(CCN(C)CCC)CC1)OCCOC |
| InChI | InChI=1S/C19H35N3O2/c1-6-9-20(4)10-11-21-12-14-22(15-13-21)18(2)7-8-19(3)24-17-16-23-5/h7-8H,2-3,6,9-17H2,1,4-5H3/b8-7- |
| InChIKey | NBIXFUJAYCSMPX-FPLPWBNLSA-N |
| XLogP | 2.19 |
| TPSA | 28.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.51 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|