C18H30F3N3O2 — CID 162582991
2,2,2-trifluoro-N-[2-[4-[(3Z)-5-(2-methoxyethoxy)hexa-1,3,5-trien-2-yl]piperazin-1-yl]ethyl]-N-methylethanamine (PubChem CID 162582991) has the molecular formula C18H30F3N3O2 and a molecular weight of 377.45 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[2-[4-[(3Z)-5-(2-methoxyethoxy)hexa-1,3,5-trien-2-yl]piperazin-1-yl]ethyl]-N-methylethanamine.
| Compound Name | 2,2,2-trifluoro-N-[2-[4-[(3Z)-5-(2-methoxyethoxy)hexa-1,3,5-trien-2-yl]piperazin-1-yl]ethyl]-N-methylethanamine |
|---|---|
| PubChem CID | 162582991 |
| Molecular Formula | C18H30F3N3O2 |
| Molecular Weight | 377.45 g/mol |
| Exact Mass | 377.23 |
| IUPAC Name | 2,2,2-trifluoro-N-[2-[4-[(3Z)-5-(2-methoxyethoxy)hexa-1,3,5-trien-2-yl]piperazin-1-yl]ethyl]-N-methylethanamine |
| SMILES | C=C(/C=C\C(=C)N1CCN(CCN(C)CC(F)(F)F)CC1)OCCOC |
| InChI | InChI=1S/C18H30F3N3O2/c1-16(5-6-17(2)26-14-13-25-4)24-11-9-23(10-12-24)8-7-22(3)15-18(19,20)21/h5-6H,1-2,7-15H2,3-4H3/b6-5- |
| InChIKey | AVRWRHJHKPSRDS-WAYWQWQTSA-N |
| XLogP | 2.34 |
| TPSA | 28.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.45 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|