C18H37FN2O2 — CID 143046247
ethane;N'-[(4E)-6-ethoxy-4-fluorohepta-2,4,6-trien-3-yl]-N,N,N'-trimethylethane-1,2-diamine;methoxymethane (PubChem CID 143046247) has the molecular formula C18H37FN2O2 and a molecular weight of 332.50 g/mol. Its IUPAC name is ethane;N'-[(4E)-6-ethoxy-4-fluorohepta-2,4,6-trien-3-yl]-N,N,N'-trimethylethane-1,2-diamine;methoxymethane.
| Compound Name | ethane;N'-[(4E)-6-ethoxy-4-fluorohepta-2,4,6-trien-3-yl]-N,N,N'-trimethylethane-1,2-diamine;methoxymethane |
|---|---|
| PubChem CID | 143046247 |
| Molecular Formula | C18H37FN2O2 |
| Molecular Weight | 332.50 g/mol |
| Exact Mass | 332.28 |
| IUPAC Name | ethane;N'-[(4E)-6-ethoxy-4-fluorohepta-2,4,6-trien-3-yl]-N,N,N'-trimethylethane-1,2-diamine;methoxymethane |
| SMILES | C=C(/C=C(/F)C(=CC)N(C)CCN(C)C)OCC.CC.COC |
| InChI | InChI=1S/C14H25FN2O.C2H6O.C2H6/c1-7-14(17(6)10-9-16(4)5)13(15)11-12(3)18-8-2;1-3-2;1-2/h7,11H,3,8-10H2,1-2,4-6H3;1-2H3;1-2H3/b13-11+,14-7?;; |
| InChIKey | RQYUSIDXCWKHLE-TZWFFARSSA-N |
| XLogP | 4.08 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.50 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|