C14H25FN2O — CID 143046248
N'-[(4E)-6-ethoxy-4-fluorohepta-2,4,6-trien-3-yl]-N,N,N'-trimethylethane-1,2-diamine (PubChem CID 143046248) has the molecular formula C14H25FN2O and a molecular weight of 256.36 g/mol. Its IUPAC name is N'-[(4E)-6-ethoxy-4-fluorohepta-2,4,6-trien-3-yl]-N,N,N'-trimethylethane-1,2-diamine.
| Compound Name | N'-[(4E)-6-ethoxy-4-fluorohepta-2,4,6-trien-3-yl]-N,N,N'-trimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 143046248 |
| Molecular Formula | C14H25FN2O |
| Molecular Weight | 256.36 g/mol |
| Exact Mass | 256.20 |
| IUPAC Name | N'-[(4E)-6-ethoxy-4-fluorohepta-2,4,6-trien-3-yl]-N,N,N'-trimethylethane-1,2-diamine |
| SMILES | C=C(/C=C(/F)C(=CC)N(C)CCN(C)C)OCC |
| InChI | InChI=1S/C14H25FN2O/c1-7-14(17(6)10-9-16(4)5)13(15)11-12(3)18-8-2/h7,11H,3,8-10H2,1-2,4-6H3/b13-11+,14-7? |
| InChIKey | ADAKKUXAQRIJKP-XWBYGLDUSA-N |
| XLogP | 2.79 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.36 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|