C14H27FN2O2 — CID 143431663
N'-[(2E,4E)-2-fluoro-4-(2-methoxyethoxy)hexa-2,4-dienyl]-N,N,N'-trimethylethane-1,2-diamine (PubChem CID 143431663) has the molecular formula C14H27FN2O2 and a molecular weight of 274.38 g/mol. Its IUPAC name is N'-[(2E,4E)-2-fluoro-4-(2-methoxyethoxy)hexa-2,4-dienyl]-N,N,N'-trimethylethane-1,2-diamine.
| Compound Name | N'-[(2E,4E)-2-fluoro-4-(2-methoxyethoxy)hexa-2,4-dienyl]-N,N,N'-trimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 143431663 |
| Molecular Formula | C14H27FN2O2 |
| Molecular Weight | 274.38 g/mol |
| Exact Mass | 274.21 |
| IUPAC Name | N'-[(2E,4E)-2-fluoro-4-(2-methoxyethoxy)hexa-2,4-dienyl]-N,N,N'-trimethylethane-1,2-diamine |
| SMILES | C/C=C(\C=C(\F)CN(C)CCN(C)C)OCCOC |
| InChI | InChI=1S/C14H27FN2O2/c1-6-14(19-10-9-18-5)11-13(15)12-17(4)8-7-16(2)3/h6,11H,7-10,12H2,1-5H3/b13-11+,14-6+ |
| InChIKey | HDMMDCVHRGKXMB-LGIZEKQVSA-N |
| XLogP | 1.90 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.38 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|