C14H26N2O — CID 145309845
N'-[(3E)-3-ethoxyhexa-1,3,5-trien-2-yl]-N-ethyl-N,N'-dimethylethane-1,2-diamine (PubChem CID 145309845) has the molecular formula C14H26N2O and a molecular weight of 238.37 g/mol. Its IUPAC name is N'-[(3E)-3-ethoxyhexa-1,3,5-trien-2-yl]-N-ethyl-N,N'-dimethylethane-1,2-diamine.
| Compound Name | N'-[(3E)-3-ethoxyhexa-1,3,5-trien-2-yl]-N-ethyl-N,N'-dimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 145309845 |
| Molecular Formula | C14H26N2O |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.20 |
| IUPAC Name | N'-[(3E)-3-ethoxyhexa-1,3,5-trien-2-yl]-N-ethyl-N,N'-dimethylethane-1,2-diamine |
| SMILES | C=C/C=C(/OCC)C(=C)N(C)CCN(C)CC |
| InChI | InChI=1S/C14H26N2O/c1-7-10-14(17-9-3)13(4)16(6)12-11-15(5)8-2/h7,10H,1,4,8-9,11-12H2,2-3,5-6H3/b14-10+ |
| InChIKey | IBTXXZFIYWCGCN-GXDHUFHOSA-N |
| XLogP | 2.49 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|