C15H11N3 — CID 143047190
3,10,11-triazatetracyclo[12.4.0.02,7.08,13]octadeca-1(18),2(7),3,5,8,12,14,16-octaene (PubChem CID 143047190) has the molecular formula C15H11N3 and a molecular weight of 233.27 g/mol. Its IUPAC name is 3,10,11-triazatetracyclo[12.4.0.02,7.08,13]octadeca-1(18),2(7),3,5,8,12,14,16-octaene.
| Compound Name | 3,10,11-triazatetracyclo[12.4.0.02,7.08,13]octadeca-1(18),2(7),3,5,8,12,14,16-octaene |
|---|---|
| PubChem CID | 143047190 |
| Molecular Formula | C15H11N3 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.10 |
| IUPAC Name | 3,10,11-triazatetracyclo[12.4.0.02,7.08,13]octadeca-1(18),2(7),3,5,8,12,14,16-octaene |
| SMILES | C1=c2c(c3cccnc3c3ccccc23)=CNN1 |
| InChI | InChI=1S/C15H11N3/c1-2-5-11-10(4-1)13-8-17-18-9-14(13)12-6-3-7-16-15(11)12/h1-9,17-18H |
| InChIKey | VBHFXHLPRCIYNI-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|