C22H40N2O4 — CID 143047983
2-[[2-[[5-methyl-4-(4-methylhex-1-en-2-yloxy)non-1-en-2-yl]amino]acetyl]amino]propanoic acid (PubChem CID 143047983) has the molecular formula C22H40N2O4 and a molecular weight of 396.57 g/mol. Its IUPAC name is 2-[[2-[[5-methyl-4-(4-methylhex-1-en-2-yloxy)non-1-en-2-yl]amino]acetyl]amino]propanoic acid.
| Compound Name | 2-[[2-[[5-methyl-4-(4-methylhex-1-en-2-yloxy)non-1-en-2-yl]amino]acetyl]amino]propanoic acid |
|---|---|
| PubChem CID | 143047983 |
| Molecular Formula | C22H40N2O4 |
| Molecular Weight | 396.57 g/mol |
| Exact Mass | 396.30 |
| IUPAC Name | 2-[[2-[[5-methyl-4-(4-methylhex-1-en-2-yloxy)non-1-en-2-yl]amino]acetyl]amino]propanoic acid |
| SMILES | C=C(CC(OC(=C)CC(C)CC)C(C)CCCC)NCC(=O)NC(C)C(=O)O |
| InChI | InChI=1S/C22H40N2O4/c1-8-10-11-16(4)20(28-18(6)12-15(3)9-2)13-17(5)23-14-21(25)24-19(7)22(26)27/h15-16,19-20,23H,5-6,8-14H2,1-4,7H3,(H,24,25)(H,26,27) |
| InChIKey | CSWYKMSJAIKAHX-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.57 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|