C24H38O2S — CID 143048207
(3E)-2-[4-(5-cyclohexa-1,5-dien-1-ylpentylsulfinyl)butyl]-3-ethenyl-2-methylhexa-3,5-dien-1-ol (PubChem CID 143048207) has the molecular formula C24H38O2S and a molecular weight of 390.63 g/mol. Its IUPAC name is (3E)-2-[4-(5-cyclohexa-1,5-dien-1-ylpentylsulfinyl)butyl]-3-ethenyl-2-methylhexa-3,5-dien-1-ol.
| Compound Name | (3E)-2-[4-(5-cyclohexa-1,5-dien-1-ylpentylsulfinyl)butyl]-3-ethenyl-2-methylhexa-3,5-dien-1-ol |
|---|---|
| PubChem CID | 143048207 |
| Molecular Formula | C24H38O2S |
| Molecular Weight | 390.63 g/mol |
| Exact Mass | 390.26 |
| IUPAC Name | (3E)-2-[4-(5-cyclohexa-1,5-dien-1-ylpentylsulfinyl)butyl]-3-ethenyl-2-methylhexa-3,5-dien-1-ol |
| SMILES | C=C/C=C(\C=C)C(C)(CO)CCCCS(=O)CCCCCC1=CCCC=C1 |
| InChI | InChI=1S/C24H38O2S/c1-4-14-23(5-2)24(3,21-25)18-11-13-20-27(26)19-12-7-10-17-22-15-8-6-9-16-22/h4-5,8,14-16,25H,1-2,6-7,9-13,17-21H2,3H3/b23-14+ |
| InChIKey | QRSRFKQZCAMCIZ-OEAKJJBVSA-N |
| XLogP | 6.04 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.63 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|