C20H30O2S — CID 168897157
[3-methyl-5-[(1E,3E)-2-methyl-4-(2,6,6-trimethylcyclohexen-1-yl)buta-1,3-dienyl]-1-oxo-2,5-dihydrothiophen-2-yl]methanol (PubChem CID 168897157) has the molecular formula C20H30O2S and a molecular weight of 334.53 g/mol. Its IUPAC name is [3-methyl-5-[(1E,3E)-2-methyl-4-(2,6,6-trimethylcyclohexen-1-yl)buta-1,3-dienyl]-1-oxo-2,5-dihydrothiophen-2-yl]methanol.
| Compound Name | [3-methyl-5-[(1E,3E)-2-methyl-4-(2,6,6-trimethylcyclohexen-1-yl)buta-1,3-dienyl]-1-oxo-2,5-dihydrothiophen-2-yl]methanol |
|---|---|
| PubChem CID | 168897157 |
| Molecular Formula | C20H30O2S |
| Molecular Weight | 334.53 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | [3-methyl-5-[(1E,3E)-2-methyl-4-(2,6,6-trimethylcyclohexen-1-yl)buta-1,3-dienyl]-1-oxo-2,5-dihydrothiophen-2-yl]methanol |
| SMILES | CC1=CC(/C=C(C)/C=C/C2=C(C)CCCC2(C)C)S(=O)C1CO |
| InChI | InChI=1S/C20H30O2S/c1-14(11-17-12-16(3)19(13-21)23(17)22)8-9-18-15(2)7-6-10-20(18,4)5/h8-9,11-12,17,19,21H,6-7,10,13H2,1-5H3/b9-8+,14-11+ |
| InChIKey | QXUGWVPDOUPZFY-HUKVCQRGSA-N |
| XLogP | 4.45 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.53 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|