C20H22NO5+ — CID 143048275
[2-[(2S)-2-(3-benzoylphenyl)propanoyl]oxy-1-carboxypropyl]azanium (PubChem CID 143048275) has the molecular formula C20H22NO5+ and a molecular weight of 356.40 g/mol. Its IUPAC name is [2-[(2S)-2-(3-benzoylphenyl)propanoyl]oxy-1-carboxypropyl]azanium.
| Compound Name | [2-[(2S)-2-(3-benzoylphenyl)propanoyl]oxy-1-carboxypropyl]azanium |
|---|---|
| PubChem CID | 143048275 |
| Molecular Formula | C20H22NO5+ |
| Molecular Weight | 356.40 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | [2-[(2S)-2-(3-benzoylphenyl)propanoyl]oxy-1-carboxypropyl]azanium |
| SMILES | CC(OC(=O)[C@@H](C)c1cccc(C(=O)c2ccccc2)c1)C([NH3+])C(=O)O |
| InChI | InChI=1S/C20H21NO5/c1-12(20(25)26-13(2)17(21)19(23)24)15-9-6-10-16(11-15)18(22)14-7-4-3-5-8-14/h3-13,17H,21H2,1-2H3,(H,23,24)/p+1/t12-,13?,17?/m0/s1 |
| InChIKey | HADQDFSMKSXZKJ-POZPTJLLSA-O |
| XLogP | 1.65 |
| TPSA | 108.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.40 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |