C14H20N2O2 — CID 143049261
N-(2-acetyl-3,4-dihydro-1H-isoquinolin-8-yl)prop-2-enamide;molecular hydrogen (PubChem CID 143049261) has the molecular formula C14H20N2O2 and a molecular weight of 248.33 g/mol. Its IUPAC name is N-(2-acetyl-3,4-dihydro-1H-isoquinolin-8-yl)prop-2-enamide;molecular hydrogen.
| Compound Name | N-(2-acetyl-3,4-dihydro-1H-isoquinolin-8-yl)prop-2-enamide;molecular hydrogen |
|---|---|
| PubChem CID | 143049261 |
| Molecular Formula | C14H20N2O2 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.15 |
| IUPAC Name | N-(2-acetyl-3,4-dihydro-1H-isoquinolin-8-yl)prop-2-enamide;molecular hydrogen |
| SMILES | C=CC(=O)Nc1cccc2c1CN(C(C)=O)CC2.[H][H].[H][H] |
| InChI | InChI=1S/C14H16N2O2.2H2/c1-3-14(18)15-13-6-4-5-11-7-8-16(10(2)17)9-12(11)13;;/h3-6H,1,7-9H2,2H3,(H,15,18);2*1H |
| InChIKey | WCALENSIFKBMNZ-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|