C11H24N4O — CID 143050182
(2R)-1-(aminodiazenyl)-3-(5-ethyl-2-methylpiperidin-1-yl)propan-2-ol (PubChem CID 143050182) has the molecular formula C11H24N4O and a molecular weight of 228.34 g/mol. Its IUPAC name is (2R)-1-(aminodiazenyl)-3-(5-ethyl-2-methylpiperidin-1-yl)propan-2-ol.
| Compound Name | (2R)-1-(aminodiazenyl)-3-(5-ethyl-2-methylpiperidin-1-yl)propan-2-ol |
|---|---|
| PubChem CID | 143050182 |
| Molecular Formula | C11H24N4O |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.20 |
| IUPAC Name | (2R)-1-(aminodiazenyl)-3-(5-ethyl-2-methylpiperidin-1-yl)propan-2-ol |
| SMILES | CCC1CCC(C)N(C[C@@H](O)C/N=N/N)C1 |
| InChI | InChI=1S/C11H24N4O/c1-3-10-5-4-9(2)15(7-10)8-11(16)6-13-14-12/h9-11,16H,3-8H2,1-2H3,(H2,12,13)/t9?,10?,11-/m0/s1 |
| InChIKey | QSLKSKUDWDSWOM-ILDUYXDCSA-N |
| XLogP | 1.18 |
| TPSA | 74.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|