C16H24N4O2 — CID 143055722
3-imino-2-(4-methoxy-2-methylphenyl)butanenitrile;propylurea (PubChem CID 143055722) has the molecular formula C16H24N4O2 and a molecular weight of 304.39 g/mol. Its IUPAC name is 3-imino-2-(4-methoxy-2-methylphenyl)butanenitrile;propylurea.
| Compound Name | 3-imino-2-(4-methoxy-2-methylphenyl)butanenitrile;propylurea |
|---|---|
| PubChem CID | 143055722 |
| Molecular Formula | C16H24N4O2 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.19 |
| IUPAC Name | 3-imino-2-(4-methoxy-2-methylphenyl)butanenitrile;propylurea |
| SMILES | CCCNC(N)=O.[H]/N=C(\C)C(C#N)c1ccc(OC)cc1C |
| InChI | InChI=1S/C12H14N2O.C4H10N2O/c1-8-6-10(15-3)4-5-11(8)12(7-13)9(2)14;1-2-3-6-4(5)7/h4-6,12,14H,1-3H3;2-3H2,1H3,(H3,5,6,7)/b14-9+; |
| InChIKey | BKIUBTHVJWULLD-KYIGKLDSSA-N |
| XLogP | 2.72 |
| TPSA | 111.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|