C31H44FN3O7 — CID 143056157
(Z)-2-[[(2S)-1-[2-[[1-(4-fluorophenyl)-4-methyl-2-oxopentan-3-yl]oxycarbonylamino]acetyl]pyrrolidine-2-carbonyl]amino]-3-methyldec-4-enoic acid (PubChem CID 143056157) has the molecular formula C31H44FN3O7 and a molecular weight of 589.71 g/mol. Its IUPAC name is (Z)-2-[[(2S)-1-[2-[[1-(4-fluorophenyl)-4-methyl-2-oxopentan-3-yl]oxycarbonylamino]acetyl]pyrrolidine-2-carbonyl]amino]-3-methyldec-4-enoic acid.
| Compound Name | (Z)-2-[[(2S)-1-[2-[[1-(4-fluorophenyl)-4-methyl-2-oxopentan-3-yl]oxycarbonylamino]acetyl]pyrrolidine-2-carbonyl]amino]-3-methyldec-4-enoic acid |
|---|---|
| PubChem CID | 143056157 |
| Molecular Formula | C31H44FN3O7 |
| Molecular Weight | 589.71 g/mol |
| Exact Mass | 589.32 |
| IUPAC Name | (Z)-2-[[(2S)-1-[2-[[1-(4-fluorophenyl)-4-methyl-2-oxopentan-3-yl]oxycarbonylamino]acetyl]pyrrolidine-2-carbonyl]amino]-3-methyldec-4-enoic acid |
| SMILES | CCCCC/C=C\C(C)C(NC(=O)[C@@H]1CCCN1C(=O)CNC(=O)OC(C(=O)Cc1ccc(F)cc1)C(C)C)C(=O)O |
| InChI | InChI=1S/C31H44FN3O7/c1-5-6-7-8-9-11-21(4)27(30(39)40)34-29(38)24-12-10-17-35(24)26(37)19-33-31(41)42-28(20(2)3)25(36)18-22-13-15-23(32)16-14-22/h9,11,13-16,20-21,24,27-28H,5-8,10,12,17-19H2,1-4H3,(H,33,41)(H,34,38)(H,39,40)/b11-9-/t21?,24-,27?,28?/m0/s1 |
| InChIKey | HUOJRKMPZSLYCH-CZMSZGPHSA-N |
| XLogP | 4.02 |
| TPSA | 142.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.71 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|