C29H33FN6O3 — CID 143056875
ethyl (2Z)-6-(2-fluorophenyl)-1-(methylideneamino)-2-[[[(3Z,5E)-2-methyl-5-pyridin-4-yloxyocta-3,5-dienyl]amino]methylimino]pyrimidine-5-carboxylate (PubChem CID 143056875) has the molecular formula C29H33FN6O3 and a molecular weight of 532.62 g/mol. Its IUPAC name is ethyl (2Z)-6-(2-fluorophenyl)-1-(methylideneamino)-2-[[[(3Z,5E)-2-methyl-5-pyridin-4-yloxyocta-3,5-dienyl]amino]methylimino]pyrimidine-5-carboxylate.
| Compound Name | ethyl (2Z)-6-(2-fluorophenyl)-1-(methylideneamino)-2-[[[(3Z,5E)-2-methyl-5-pyridin-4-yloxyocta-3,5-dienyl]amino]methylimino]pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 143056875 |
| Molecular Formula | C29H33FN6O3 |
| Molecular Weight | 532.62 g/mol |
| Exact Mass | 532.26 |
| IUPAC Name | ethyl (2Z)-6-(2-fluorophenyl)-1-(methylideneamino)-2-[[[(3Z,5E)-2-methyl-5-pyridin-4-yloxyocta-3,5-dienyl]amino]methylimino]pyrimidine-5-carboxylate |
| SMILES | C=Nn1c(-c2ccccc2F)c(C(=O)OCC)cn/c1=N/CNCC(C)/C=C\C(=C/CC)Oc1ccncc1 |
| InChI | InChI=1S/C29H33FN6O3/c1-5-9-22(39-23-14-16-32-17-15-23)13-12-21(3)18-33-20-35-29-34-19-25(28(37)38-6-2)27(36(29)31-4)24-10-7-8-11-26(24)30/h7-17,19,21,33H,4-6,18,20H2,1-3H3/b13-12-,22-9+,35-29- |
| InChIKey | ZYSJEBPBCPGYOO-VCSHLCMFSA-N |
| XLogP | 4.74 |
| TPSA | 102.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.62 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|