C30H33N3O4 — CID 143058681
3-[4-[3-[[[4-[(E)-2-cyanoethenyl]-2-ethenyl-5-ethyl-1,2,3,4-tetrahydropyridine-6-carbonyl]amino]methyl]phenoxy]-2-methylphenyl]propanoic acid (PubChem CID 143058681) has the molecular formula C30H33N3O4 and a molecular weight of 499.61 g/mol. Its IUPAC name is 3-[4-[3-[[[4-[(E)-2-cyanoethenyl]-2-ethenyl-5-ethyl-1,2,3,4-tetrahydropyridine-6-carbonyl]amino]methyl]phenoxy]-2-methylphenyl]propanoic acid.
| Compound Name | 3-[4-[3-[[[4-[(E)-2-cyanoethenyl]-2-ethenyl-5-ethyl-1,2,3,4-tetrahydropyridine-6-carbonyl]amino]methyl]phenoxy]-2-methylphenyl]propanoic acid |
|---|---|
| PubChem CID | 143058681 |
| Molecular Formula | C30H33N3O4 |
| Molecular Weight | 499.61 g/mol |
| Exact Mass | 499.25 |
| IUPAC Name | 3-[4-[3-[[[4-[(E)-2-cyanoethenyl]-2-ethenyl-5-ethyl-1,2,3,4-tetrahydropyridine-6-carbonyl]amino]methyl]phenoxy]-2-methylphenyl]propanoic acid |
| SMILES | C=CC1CC(/C=C/C#N)C(CC)=C(C(=O)NCc2cccc(Oc3ccc(CCC(=O)O)c(C)c3)c2)N1 |
| InChI | InChI=1S/C30H33N3O4/c1-4-24-18-23(9-7-15-31)27(5-2)29(33-24)30(36)32-19-21-8-6-10-25(17-21)37-26-13-11-22(20(3)16-26)12-14-28(34)35/h4,6-11,13,16-17,23-24,33H,1,5,12,14,18-19H2,2-3H3,(H,32,36)(H,34,35)/b9-7+ |
| InChIKey | RBOXHLRUIMKONU-VQHVLOKHSA-N |
| XLogP | 5.33 |
| TPSA | 111.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.61 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|