C40H54N4O2 — CID 143059904
N,N-bis(3-methylbutyl)-2-(4-phenylmethoxyphenyl)-3-(4-piperidin-1-ylbutyl)benzimidazole-5-carboxamide (PubChem CID 143059904) has the molecular formula C40H54N4O2 and a molecular weight of 622.90 g/mol. Its IUPAC name is N,N-bis(3-methylbutyl)-2-(4-phenylmethoxyphenyl)-3-(4-piperidin-1-ylbutyl)benzimidazole-5-carboxamide.
| Compound Name | N,N-bis(3-methylbutyl)-2-(4-phenylmethoxyphenyl)-3-(4-piperidin-1-ylbutyl)benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 143059904 |
| Molecular Formula | C40H54N4O2 |
| Molecular Weight | 622.90 g/mol |
| Exact Mass | 622.42 |
| IUPAC Name | N,N-bis(3-methylbutyl)-2-(4-phenylmethoxyphenyl)-3-(4-piperidin-1-ylbutyl)benzimidazole-5-carboxamide |
| SMILES | CC(C)CCN(CCC(C)C)C(=O)c1ccc2nc(-c3ccc(OCc4ccccc4)cc3)n(CCCCN3CCCCC3)c2c1 |
| InChI | InChI=1S/C40H54N4O2/c1-31(2)21-27-43(28-22-32(3)4)40(45)35-17-20-37-38(29-35)44(26-12-11-25-42-23-9-6-10-24-42)39(41-37)34-15-18-36(19-16-34)46-30-33-13-7-5-8-14-33/h5,7-8,13-20,29,31-32H,6,9-12,21-28,30H2,1-4H3 |
| InChIKey | FJGLSRLURRFYPH-UHFFFAOYSA-N |
| XLogP | 9.08 |
| TPSA | 50.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.90 |
| LogP ≤ 5 | 9.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|