C32H47N5O — CID 58770907
N,N-dibutyl-2-[4-(dimethylamino)phenyl]-3-(3-piperidin-1-ylpropyl)benzimidazole-5-carboxamide (PubChem CID 58770907) has the molecular formula C32H47N5O and a molecular weight of 517.76 g/mol. Its IUPAC name is N,N-dibutyl-2-[4-(dimethylamino)phenyl]-3-(3-piperidin-1-ylpropyl)benzimidazole-5-carboxamide.
| Compound Name | N,N-dibutyl-2-[4-(dimethylamino)phenyl]-3-(3-piperidin-1-ylpropyl)benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 58770907 |
| Molecular Formula | C32H47N5O |
| Molecular Weight | 517.76 g/mol |
| Exact Mass | 517.38 |
| IUPAC Name | N,N-dibutyl-2-[4-(dimethylamino)phenyl]-3-(3-piperidin-1-ylpropyl)benzimidazole-5-carboxamide |
| SMILES | CCCCN(CCCC)C(=O)c1ccc2nc(-c3ccc(N(C)C)cc3)n(CCCN3CCCCC3)c2c1 |
| InChI | InChI=1S/C32H47N5O/c1-5-7-22-36(23-8-6-2)32(38)27-15-18-29-30(25-27)37(24-12-21-35-19-10-9-11-20-35)31(33-29)26-13-16-28(17-14-26)34(3)4/h13-18,25H,5-12,19-24H2,1-4H3 |
| InChIKey | BMLRYEDWXWSURD-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 44.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.76 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'} |
|---|