C31H43N5O3 — CID 143059864
3-[3-(azepan-1-yl)propyl]-N,N-dibutyl-2-(3-nitrophenyl)benzimidazole-5-carboxamide (PubChem CID 143059864) has the molecular formula C31H43N5O3 and a molecular weight of 533.72 g/mol. Its IUPAC name is 3-[3-(azepan-1-yl)propyl]-N,N-dibutyl-2-(3-nitrophenyl)benzimidazole-5-carboxamide.
| Compound Name | 3-[3-(azepan-1-yl)propyl]-N,N-dibutyl-2-(3-nitrophenyl)benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 143059864 |
| Molecular Formula | C31H43N5O3 |
| Molecular Weight | 533.72 g/mol |
| Exact Mass | 533.34 |
| IUPAC Name | 3-[3-(azepan-1-yl)propyl]-N,N-dibutyl-2-(3-nitrophenyl)benzimidazole-5-carboxamide |
| SMILES | CCCCN(CCCC)C(=O)c1ccc2nc(-c3cccc([N+](=O)[O-])c3)n(CCCN3CCCCCC3)c2c1 |
| InChI | InChI=1S/C31H43N5O3/c1-3-5-20-34(21-6-4-2)31(37)26-15-16-28-29(24-26)35(22-12-19-33-17-9-7-8-10-18-33)30(32-28)25-13-11-14-27(23-25)36(38)39/h11,13-16,23-24H,3-10,12,17-22H2,1-2H3 |
| InChIKey | YXXXWBIUAJSPDY-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 84.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.72 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|