C34H51N5O — CID 58770884
N,N-dibutyl-2-[4-(diethylamino)phenyl]-3-(3-piperidin-1-ylpropyl)benzimidazole-5-carboxamide (PubChem CID 58770884) has the molecular formula C34H51N5O and a molecular weight of 545.82 g/mol. Its IUPAC name is N,N-dibutyl-2-[4-(diethylamino)phenyl]-3-(3-piperidin-1-ylpropyl)benzimidazole-5-carboxamide.
| Compound Name | N,N-dibutyl-2-[4-(diethylamino)phenyl]-3-(3-piperidin-1-ylpropyl)benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 58770884 |
| Molecular Formula | C34H51N5O |
| Molecular Weight | 545.82 g/mol |
| Exact Mass | 545.41 |
| IUPAC Name | N,N-dibutyl-2-[4-(diethylamino)phenyl]-3-(3-piperidin-1-ylpropyl)benzimidazole-5-carboxamide |
| SMILES | CCCCN(CCCC)C(=O)c1ccc2nc(-c3ccc(N(CC)CC)cc3)n(CCCN3CCCCC3)c2c1 |
| InChI | InChI=1S/C34H51N5O/c1-5-9-24-38(25-10-6-2)34(40)29-17-20-31-32(27-29)39(26-14-23-36-21-12-11-13-22-36)33(35-31)28-15-18-30(19-16-28)37(7-3)8-4/h15-20,27H,5-14,21-26H2,1-4H3 |
| InChIKey | MEQVAORDTSWRHP-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 44.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.82 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'} |
|---|