C12H13N2P — CID 143060384
[2-(2,5-dimethylphenyl)pyrimidin-4-yl]phosphane (PubChem CID 143060384) has the molecular formula C12H13N2P and a molecular weight of 216.22 g/mol. Its IUPAC name is [2-(2,5-dimethylphenyl)pyrimidin-4-yl]phosphane.
| Compound Name | [2-(2,5-dimethylphenyl)pyrimidin-4-yl]phosphane |
|---|---|
| PubChem CID | 143060384 |
| Molecular Formula | C12H13N2P |
| Molecular Weight | 216.22 g/mol |
| Exact Mass | 216.08 |
| IUPAC Name | [2-(2,5-dimethylphenyl)pyrimidin-4-yl]phosphane |
| SMILES | Cc1ccc(C)c(-c2nccc(P)n2)c1 |
| InChI | InChI=1S/C12H13N2P/c1-8-3-4-9(2)10(7-8)12-13-6-5-11(15)14-12/h3-7H,15H2,1-2H3 |
| InChIKey | ZMEYJBKDBUMKQX-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.22 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|