C15H12ClN3O — CID 97057852
5-(2-chloro-3-pyridinyl)-3-(2,5-dimethylphenyl)-1,2,4-oxadiazole (PubChem CID 97057852) has the molecular formula C15H12ClN3O and a molecular weight of 285.73 g/mol. Its IUPAC name is 5-(2-chloro-3-pyridinyl)-3-(2,5-dimethylphenyl)-1,2,4-oxadiazole.
| Compound Name | 5-(2-chloro-3-pyridinyl)-3-(2,5-dimethylphenyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 97057852 |
| Molecular Formula | C15H12ClN3O |
| Molecular Weight | 285.73 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | 5-(2-chloro-3-pyridinyl)-3-(2,5-dimethylphenyl)-1,2,4-oxadiazole |
| SMILES | Cc1ccc(C)c(-c2noc(-c3cccnc3Cl)n2)c1 |
| InChI | InChI=1S/C15H12ClN3O/c1-9-5-6-10(2)12(8-9)14-18-15(20-19-14)11-4-3-7-17-13(11)16/h3-8H,1-2H3 |
| InChIKey | RSLYKEXCEGMBTB-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.73 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|