C8H3ClF3N3O — CID 50853279
3-(2-chloro-3-pyridinyl)-5-(trifluoromethyl)-1,2,4-oxadiazole (PubChem CID 50853279) has the molecular formula C8H3ClF3N3O and a molecular weight of 249.58 g/mol. Its IUPAC name is 3-(2-chloro-3-pyridinyl)-5-(trifluoromethyl)-1,2,4-oxadiazole.
| Compound Name | 3-(2-chloro-3-pyridinyl)-5-(trifluoromethyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 50853279 |
| Molecular Formula | C8H3ClF3N3O |
| Molecular Weight | 249.58 g/mol |
| Exact Mass | 248.99 |
| IUPAC Name | 3-(2-chloro-3-pyridinyl)-5-(trifluoromethyl)-1,2,4-oxadiazole |
| SMILES | FC(F)(F)c1nc(-c2cccnc2Cl)no1 |
| InChI | InChI=1S/C8H3ClF3N3O/c9-5-4(2-1-3-13-5)6-14-7(16-15-6)8(10,11)12/h1-3H |
| InChIKey | PRBWYBRXXRCGDO-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.58 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|