C10H6F3N3OS — CID 168862218
2-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]benzenecarbothioamide (PubChem CID 168862218) has the molecular formula C10H6F3N3OS and a molecular weight of 273.24 g/mol. Its IUPAC name is 2-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]benzenecarbothioamide.
| Compound Name | 2-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]benzenecarbothioamide |
|---|---|
| PubChem CID | 168862218 |
| Molecular Formula | C10H6F3N3OS |
| Molecular Weight | 273.24 g/mol |
| Exact Mass | 273.02 |
| IUPAC Name | 2-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]benzenecarbothioamide |
| SMILES | NC(=S)c1ccccc1-c1noc(C(F)(F)F)n1 |
| InChI | InChI=1S/C10H6F3N3OS/c11-10(12,13)9-15-8(16-17-9)6-4-2-1-3-5(6)7(14)18/h1-4H,(H2,14,18) |
| InChIKey | SCEZFAFOIWIVOZ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.24 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|