C14H12F5N3O2S — CID 151236696
N-[[2,3-difluoro-4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]-N-methoxypropanethioamide (PubChem CID 151236696) has the molecular formula C14H12F5N3O2S and a molecular weight of 381.33 g/mol. Its IUPAC name is N-[[2,3-difluoro-4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]-N-methoxypropanethioamide.
| Compound Name | N-[[2,3-difluoro-4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]-N-methoxypropanethioamide |
|---|---|
| PubChem CID | 151236696 |
| Molecular Formula | C14H12F5N3O2S |
| Molecular Weight | 381.33 g/mol |
| Exact Mass | 381.06 |
| IUPAC Name | N-[[2,3-difluoro-4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]-N-methoxypropanethioamide |
| SMILES | CCC(=S)N(Cc1ccc(-c2noc(C(F)(F)F)n2)c(F)c1F)OC |
| InChI | InChI=1S/C14H12F5N3O2S/c1-3-9(25)22(23-2)6-7-4-5-8(11(16)10(7)15)12-20-13(24-21-12)14(17,18)19/h4-5H,3,6H2,1-2H3 |
| InChIKey | NPKRXXXACNOWRY-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 51.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.33 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|