C12H12F3N3O3S — CID 159971292
N-methoxy-N-[[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]thiophen-2-yl]methyl]propanamide (PubChem CID 159971292) has the molecular formula C12H12F3N3O3S and a molecular weight of 335.31 g/mol. Its IUPAC name is N-methoxy-N-[[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]thiophen-2-yl]methyl]propanamide.
| Compound Name | N-methoxy-N-[[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]thiophen-2-yl]methyl]propanamide |
|---|---|
| PubChem CID | 159971292 |
| Molecular Formula | C12H12F3N3O3S |
| Molecular Weight | 335.31 g/mol |
| Exact Mass | 335.06 |
| IUPAC Name | N-methoxy-N-[[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]thiophen-2-yl]methyl]propanamide |
| SMILES | CCC(=O)N(Cc1cc(-c2noc(C(F)(F)F)n2)cs1)OC |
| InChI | InChI=1S/C12H12F3N3O3S/c1-3-9(19)18(20-2)5-8-4-7(6-22-8)10-16-11(21-17-10)12(13,14)15/h4,6H,3,5H2,1-2H3 |
| InChIKey | OEOQBUXOVYWCLI-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 68.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.31 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|