C18H10F3N3O2 — CID 175729542
2-(4-ethynylphenyl)-4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]benzamide (PubChem CID 175729542) has the molecular formula C18H10F3N3O2 and a molecular weight of 357.29 g/mol. Its IUPAC name is 2-(4-ethynylphenyl)-4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]benzamide.
| Compound Name | 2-(4-ethynylphenyl)-4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]benzamide |
|---|---|
| PubChem CID | 175729542 |
| Molecular Formula | C18H10F3N3O2 |
| Molecular Weight | 357.29 g/mol |
| Exact Mass | 357.07 |
| IUPAC Name | 2-(4-ethynylphenyl)-4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]benzamide |
| SMILES | C#Cc1ccc(-c2cc(-c3noc(C(F)(F)F)n3)ccc2C(N)=O)cc1 |
| InChI | InChI=1S/C18H10F3N3O2/c1-2-10-3-5-11(6-4-10)14-9-12(7-8-13(14)15(22)25)16-23-17(26-24-16)18(19,20)21/h1,3-9H,(H2,22,25) |
| InChIKey | XWFUECRKZKZDLE-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 82.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.29 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|