C14H10ClF3N6O — CID 155744140
N-[1-(6-chloro-2-pyridinyl)ethyl]-5-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]pyrimidin-2-amine (PubChem CID 155744140) has the molecular formula C14H10ClF3N6O and a molecular weight of 370.72 g/mol. Its IUPAC name is N-[1-(6-chloro-2-pyridinyl)ethyl]-5-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]pyrimidin-2-amine.
| Compound Name | N-[1-(6-chloro-2-pyridinyl)ethyl]-5-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 155744140 |
| Molecular Formula | C14H10ClF3N6O |
| Molecular Weight | 370.72 g/mol |
| Exact Mass | 370.06 |
| IUPAC Name | N-[1-(6-chloro-2-pyridinyl)ethyl]-5-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]pyrimidin-2-amine |
| SMILES | CC(Nc1ncc(-c2noc(C(F)(F)F)n2)cn1)c1cccc(Cl)n1 |
| InChI | InChI=1S/C14H10ClF3N6O/c1-7(9-3-2-4-10(15)22-9)21-13-19-5-8(6-20-13)11-23-12(25-24-11)14(16,17)18/h2-7H,1H3,(H,19,20,21) |
| InChIKey | MHCGILFVJSDKKW-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.72 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|