C41H40N2 — CID 143060434
ethane;5-[4-[4-[3-methyl-2-(2-methylbut-3-enyl)indol-1-yl]phenyl]phenyl]-6H-cyclohepta[b]indole (PubChem CID 143060434) has the molecular formula C41H40N2 and a molecular weight of 560.78 g/mol. Its IUPAC name is ethane;5-[4-[4-[3-methyl-2-(2-methylbut-3-enyl)indol-1-yl]phenyl]phenyl]-6H-cyclohepta[b]indole.
| Compound Name | ethane;5-[4-[4-[3-methyl-2-(2-methylbut-3-enyl)indol-1-yl]phenyl]phenyl]-6H-cyclohepta[b]indole |
|---|---|
| PubChem CID | 143060434 |
| Molecular Formula | C41H40N2 |
| Molecular Weight | 560.78 g/mol |
| Exact Mass | 560.32 |
| IUPAC Name | ethane;5-[4-[4-[3-methyl-2-(2-methylbut-3-enyl)indol-1-yl]phenyl]phenyl]-6H-cyclohepta[b]indole |
| SMILES | C=CC(C)Cc1c(C)c2ccccc2n1-c1ccc(-c2ccc(-n3c4c(c5ccccc53)C=CC=CC4)cc2)cc1.CC |
| InChI | InChI=1S/C39H34N2.C2H6/c1-4-27(2)26-39-28(3)33-12-8-10-16-36(33)41(39)32-24-20-30(21-25-32)29-18-22-31(23-19-29)40-37-15-7-5-6-13-34(37)35-14-9-11-17-38(35)40;1-2/h4-14,16-25,27H,1,15,26H2,2-3H3;1-2H3 |
| InChIKey | MTLWYRDRGXPLGS-UHFFFAOYSA-N |
| XLogP | 11.07 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.78 |
| LogP ≤ 5 | 11.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|